2,5-Methanopentalene, octahydro-3a,6a-dinitro-
Product Code: 998870
Molecular Formula: C9H12N2O4
Molecular Weight: 212.20
5464-15-3
1-[ethyl(methyl)amino]propan-2-ol
54644-76-7
4,7-Methano-2,1,3-benzoxadiazole, 4,5,6,7-tetrahydro-, 1-oxide
546-40-7
(22S,25S)-5,6-Didehydro-5α-spirosolane-3β-ol
54644-42-7
2,2-Dimethylpropanoic acid 2-tert-butyl-4-methylphenyl ester
54643-10-6
1-PROPANONE,1-(PYRIMIDIN-4-YL)-
54644-59-6
3-[(Phenyloxycarbonyl)oxy]benzoic acid methyl ester
5464-05-1
benzenesulfonamide, N-(2-chlorophenyl)-3-nitro-
5464-16-4
2-aminocyclopentanone
5464-46-0
triethyl 1-oxobutane-1,2,3-tricarboxylate
5464-65-3
{[(sulfanylcarbonothioyl)imino]diethane-2,1-diyl}dicarbamodithioic acid
54644-14-3
5-ETHOXY-2-PHENYLOXAZOLE-4-CARBONYL CHLORIDE
54644-44-9
2,2-Dimethylpropanoic acid 2,6-di(isopropyl)phenyl ester
54644-43-8
2,2-Dimethylpropanoic acid 2,6-bis(1,1-dimethylethyl)-4-methylphenyl ester
5464-30-2
DL-Asparticacid, N-(2-cyanoethyl)-
54644-49-4
Carbonic acid 3-methoxyphenyl=methyl
5464-10-8
1H-inden-1-one, 2,3-dihydro-6-methoxy-2-methyl-
54642-67-0
1(3H)-Isobenzofuranone,3-[4-(diethylamino)-2-ethoxyphenyl]-3-(1-ethyl-2-methyl-1H-indol-3-yl)-7-nitro-
54646-54-7
Benzene, 1-[(3-bromo-1-butenyl)sulfonyl]-4-methyl-, (E)-
5464-42-6
N-(2-carboxyethyl)-N-(phenylsulfonyl)alanine
54646-67-2
2-Naphthalenol, 3-(1,1-dimethylethyl)-
54639-77-9, CAS No. 54639-77-9,CasNo 54639-77-9,cas 54639-77-9
2,5-Methanopentalene, octahydro-3a,6a-dinitro-